C22H30O5Si — CID 58521382
6-[(2E)-3-acetylpenta-2,4-dienyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one (PubChem CID 58521382) has the molecular formula C22H30O5Si and a molecular weight of 402.56 g/mol. Its IUPAC name is 6-[(2E)-3-acetylpenta-2,4-dienyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one.
| Compound Name | 6-[(2E)-3-acetylpenta-2,4-dienyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 58521382 |
| Molecular Formula | C22H30O5Si |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 6-[(2E)-3-acetylpenta-2,4-dienyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one |
| SMILES | C=C/C(=C\Cc1c(OC)c(C)c2c(c1OCC[Si](C)(C)C)C(=O)OC2)C(C)=O |
| InChI | InChI=1S/C22H30O5Si/c1-8-16(15(3)23)9-10-17-20(25-4)14(2)18-13-27-22(24)19(18)21(17)26-11-12-28(5,6)7/h8-9H,1,10-13H2,2-7H3/b16-9+ |
| InChIKey | WASJTJKTCSOSTK-CXUHLZMHSA-N |
| XLogP | 4.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|