C32H39O7PSi — CID 57459871
6-[(E)-4-diphenoxyphosphoryl-3-methylbut-2-enyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one (PubChem CID 57459871) has the molecular formula C32H39O7PSi and a molecular weight of 594.72 g/mol. Its IUPAC name is 6-[(E)-4-diphenoxyphosphoryl-3-methylbut-2-enyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one.
| Compound Name | 6-[(E)-4-diphenoxyphosphoryl-3-methylbut-2-enyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 57459871 |
| Molecular Formula | C32H39O7PSi |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 6-[(E)-4-diphenoxyphosphoryl-3-methylbut-2-enyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one |
| SMILES | COc1c(C)c2c(c(OCC[Si](C)(C)C)c1C/C=C(\C)CP(=O)(Oc1ccccc1)Oc1ccccc1)C(=O)OC2 |
| InChI | InChI=1S/C32H39O7PSi/c1-23(22-40(34,38-25-13-9-7-10-14-25)39-26-15-11-8-12-16-26)17-18-27-30(35-3)24(2)28-21-37-32(33)29(28)31(27)36-19-20-41(4,5)6/h7-17H,18-22H2,1-6H3/b23-17+ |
| InChIKey | WOCLDLGMITYFHC-HAVVHWLPSA-N |
| XLogP | 8.23 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|