C28H39O5PSi — CID 58521173
5-ethyl-4-methyl-6-[(E)-3-methyl-4-[methyl(phenoxy)phosphoryl]but-2-enyl]-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one (PubChem CID 58521173) has the molecular formula C28H39O5PSi and a molecular weight of 514.68 g/mol. Its IUPAC name is 5-ethyl-4-methyl-6-[(E)-3-methyl-4-[methyl(phenoxy)phosphoryl]but-2-enyl]-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one.
| Compound Name | 5-ethyl-4-methyl-6-[(E)-3-methyl-4-[methyl(phenoxy)phosphoryl]but-2-enyl]-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 58521173 |
| Molecular Formula | C28H39O5PSi |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 5-ethyl-4-methyl-6-[(E)-3-methyl-4-[methyl(phenoxy)phosphoryl]but-2-enyl]-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one |
| SMILES | CCc1c(C)c2c(c(OCC[Si](C)(C)C)c1C/C=C(\C)CP(C)(=O)Oc1ccccc1)C(=O)OC2 |
| InChI | InChI=1S/C28H39O5PSi/c1-8-23-21(3)25-18-32-28(29)26(25)27(31-16-17-35(5,6)7)24(23)15-14-20(2)19-34(4,30)33-22-12-10-9-11-13-22/h9-14H,8,15-19H2,1-7H3/b20-14+ |
| InChIKey | FFVWMSLNRAUQEH-XSFVSMFZSA-N |
| XLogP | 7.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|