C29H42NO8PSi — CID 140571385
2-[benzyl-[4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl dihydrogen phosphate (PubChem CID 140571385) has the molecular formula C29H42NO8PSi and a molecular weight of 591.71 g/mol. Its IUPAC name is 2-[benzyl-[4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[benzyl-[4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 140571385 |
| Molecular Formula | C29H42NO8PSi |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 2-[benzyl-[4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl dihydrogen phosphate |
| SMILES | COc1c(C)c2c(c(OCC[Si](C)(C)C)c1CC=C(C)CN(CCOP(=O)(O)O)Cc1ccccc1)C(=O)OC2 |
| InChI | InChI=1S/C29H42NO8PSi/c1-21(18-30(14-15-38-39(32,33)34)19-23-10-8-7-9-11-23)12-13-24-27(35-3)22(2)25-20-37-29(31)26(25)28(24)36-16-17-40(4,5)6/h7-12H,13-20H2,1-6H3,(H2,32,33,34) |
| InChIKey | KAKYOPHBSNVBGG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|