C25H36F3N2O7P — CID 11238385
ethyl (2S)-2-[[2-[[(E)-4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]amino]ethyl-(2,2,2-trifluoroethoxy)phosphoryl]amino]propanoate (PubChem CID 11238385) has the molecular formula C25H36F3N2O7P and a molecular weight of 564.54 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-[[(E)-4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]amino]ethyl-(2,2,2-trifluoroethoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[2-[[(E)-4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]amino]ethyl-(2,2,2-trifluoroethoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 11238385 |
| Molecular Formula | C25H36F3N2O7P |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | ethyl (2S)-2-[[2-[[(E)-4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]amino]ethyl-(2,2,2-trifluoroethoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(CCNC/C(C)=C/Cc1c(O)c2c(c(C)c1CC)COC2=O)OCC(F)(F)F |
| InChI | InChI=1S/C25H36F3N2O7P/c1-6-18-16(4)20-13-36-24(33)21(20)22(31)19(18)9-8-15(3)12-29-10-11-38(34,37-14-25(26,27)28)30-17(5)23(32)35-7-2/h8,17,29,31H,6-7,9-14H2,1-5H3,(H,30,34)/b15-8+/t17-,38?/m0/s1 |
| InChIKey | HIGXHZVUNHIWNG-YMDXHUGGSA-N |
| XLogP | 4.33 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|