C17H23O6P — CID 72563637
[4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]-methoxyphosphinic acid (PubChem CID 72563637) has the molecular formula C17H23O6P and a molecular weight of 354.34 g/mol. Its IUPAC name is [4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]-methoxyphosphinic acid.
| Compound Name | [4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 72563637 |
| Molecular Formula | C17H23O6P |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enyl]-methoxyphosphinic acid |
| SMILES | CCc1c(C)c2c(c(O)c1CC=C(C)CP(=O)(O)OC)C(=O)OC2 |
| InChI | InChI=1S/C17H23O6P/c1-5-12-11(3)14-8-23-17(19)15(14)16(18)13(12)7-6-10(2)9-24(20,21)22-4/h6,18H,5,7-9H2,1-4H3,(H,20,21) |
| InChIKey | NXJVNKNXYZBDQT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|