C19H25IO4S — CID 143041225
(E)-2-ethyl-4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)but-2-enal;ethyl thiohypoiodite (PubChem CID 143041225) has the molecular formula C19H25IO4S and a molecular weight of 476.38 g/mol. Its IUPAC name is (E)-2-ethyl-4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)but-2-enal;ethyl thiohypoiodite.
| Compound Name | (E)-2-ethyl-4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)but-2-enal;ethyl thiohypoiodite |
|---|---|
| PubChem CID | 143041225 |
| Molecular Formula | C19H25IO4S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (E)-2-ethyl-4-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)but-2-enal;ethyl thiohypoiodite |
| SMILES | CC/C(C=O)=C\Cc1c(O)c2c(c(C)c1CC)COC2=O.CCSI |
| InChI | InChI=1S/C17H20O4.C2H5IS/c1-4-11(8-18)6-7-13-12(5-2)10(3)14-9-21-17(20)15(14)16(13)19;1-2-4-3/h6,8,19H,4-5,7,9H2,1-3H3;2H2,1H3/b11-6+; |
| InChIKey | PYHPQFHGBJEMJF-ICSBZGNSSA-N |
| XLogP | 5.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|