C19H24BrIO3S — CID 142962659
2-[[5-[(E)-3-(bromomethyl)pent-2-enyl]-6-ethyl-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite (PubChem CID 142962659) has the molecular formula C19H24BrIO3S and a molecular weight of 539.27 g/mol. Its IUPAC name is 2-[[5-[(E)-3-(bromomethyl)pent-2-enyl]-6-ethyl-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite.
| Compound Name | 2-[[5-[(E)-3-(bromomethyl)pent-2-enyl]-6-ethyl-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 142962659 |
| Molecular Formula | C19H24BrIO3S |
| Molecular Weight | 539.27 g/mol |
| Exact Mass | 537.97 |
| IUPAC Name | 2-[[5-[(E)-3-(bromomethyl)pent-2-enyl]-6-ethyl-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite |
| SMILES | CC/C(=C\Cc1c(CC)c(C)c2c(c1OCCSI)C(=O)OC2)CBr |
| InChI | InChI=1S/C19H24BrIO3S/c1-4-13(10-20)6-7-15-14(5-2)12(3)16-11-24-19(22)17(16)18(15)23-8-9-25-21/h6H,4-5,7-11H2,1-3H3/b13-6+ |
| InChIKey | PBLZVYNAUIMMRN-AWNIVKPZSA-N |
| XLogP | 5.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.27 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|