C17H20BrIO4S — CID 142962431
2-[[5-[(E)-4-bromo-3-methylbut-2-enyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite (PubChem CID 142962431) has the molecular formula C17H20BrIO4S and a molecular weight of 527.22 g/mol. Its IUPAC name is 2-[[5-[(E)-4-bromo-3-methylbut-2-enyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite.
| Compound Name | 2-[[5-[(E)-4-bromo-3-methylbut-2-enyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 142962431 |
| Molecular Formula | C17H20BrIO4S |
| Molecular Weight | 527.22 g/mol |
| Exact Mass | 525.93 |
| IUPAC Name | 2-[[5-[(E)-4-bromo-3-methylbut-2-enyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite |
| SMILES | COc1c(C)c2c(c(OCCSI)c1C/C=C(\C)CBr)C(=O)OC2 |
| InChI | InChI=1S/C17H20BrIO4S/c1-10(8-18)4-5-12-15(21-3)11(2)13-9-23-17(20)14(13)16(12)22-6-7-24-19/h4H,5-9H2,1-3H3/b10-4+ |
| InChIKey | LIVYBOORJWXFOT-ONNFQVAWSA-N |
| XLogP | 5.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.22 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|