C17H24INO4S — CID 142968071
2-[[6-[(E)-4-amino-3-methylbut-2-enyl]-7-methoxy-8-methyl-1,4-dihydro-2,3-benzodioxin-5-yl]oxy]ethyl thiohypoiodite (PubChem CID 142968071) has the molecular formula C17H24INO4S and a molecular weight of 465.35 g/mol. Its IUPAC name is 2-[[6-[(E)-4-amino-3-methylbut-2-enyl]-7-methoxy-8-methyl-1,4-dihydro-2,3-benzodioxin-5-yl]oxy]ethyl thiohypoiodite.
| Compound Name | 2-[[6-[(E)-4-amino-3-methylbut-2-enyl]-7-methoxy-8-methyl-1,4-dihydro-2,3-benzodioxin-5-yl]oxy]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 142968071 |
| Molecular Formula | C17H24INO4S |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 2-[[6-[(E)-4-amino-3-methylbut-2-enyl]-7-methoxy-8-methyl-1,4-dihydro-2,3-benzodioxin-5-yl]oxy]ethyl thiohypoiodite |
| SMILES | COc1c(C)c2c(c(OCCSI)c1C/C=C(\C)CN)COOC2 |
| InChI | InChI=1S/C17H24INO4S/c1-11(8-19)4-5-13-16(20-3)12(2)14-9-22-23-10-15(14)17(13)21-6-7-24-18/h4H,5-10,19H2,1-3H3/b11-4+ |
| InChIKey | LPMQSJWJYTXUEA-NYYWCZLTSA-N |
| XLogP | 3.87 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|