C19H25BrO6 — CID 67019129
6-(4-bromo-3-methylbut-2-enyl)-5-methoxy-7-(1-methoxyethoxymethoxy)-4-methyl-3H-2-benzofuran-1-one (PubChem CID 67019129) has the molecular formula C19H25BrO6 and a molecular weight of 429.31 g/mol. Its IUPAC name is 6-(4-bromo-3-methylbut-2-enyl)-5-methoxy-7-(1-methoxyethoxymethoxy)-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 6-(4-bromo-3-methylbut-2-enyl)-5-methoxy-7-(1-methoxyethoxymethoxy)-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 67019129 |
| Molecular Formula | C19H25BrO6 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 6-(4-bromo-3-methylbut-2-enyl)-5-methoxy-7-(1-methoxyethoxymethoxy)-4-methyl-3H-2-benzofuran-1-one |
| SMILES | COc1c(C)c2c(c(OCOC(C)OC)c1CC=C(C)CBr)C(=O)OC2 |
| InChI | InChI=1S/C19H25BrO6/c1-11(8-20)6-7-14-17(23-5)12(2)15-9-24-19(21)16(15)18(14)26-10-25-13(3)22-4/h6,13H,7-10H2,1-5H3 |
| InChIKey | NVDVCBSZLSQFPG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|