C26H43INO5PS — CID 143041182
ethane;2-[[5-[(E)-3-[[2-[ethoxy(methoxy)phosphanyl]ethylamino]methyl]pent-2-enyl]-6-ethyl-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite (PubChem CID 143041182) has the molecular formula C26H43INO5PS and a molecular weight of 639.58 g/mol. Its IUPAC name is ethane;2-[[5-[(E)-3-[[2-[ethoxy(methoxy)phosphanyl]ethylamino]methyl]pent-2-enyl]-6-ethyl-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite.
| Compound Name | ethane;2-[[5-[(E)-3-[[2-[ethoxy(methoxy)phosphanyl]ethylamino]methyl]pent-2-enyl]-6-ethyl-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite |
|---|---|
| PubChem CID | 143041182 |
| Molecular Formula | C26H43INO5PS |
| Molecular Weight | 639.58 g/mol |
| Exact Mass | 639.16 |
| IUPAC Name | ethane;2-[[5-[(E)-3-[[2-[ethoxy(methoxy)phosphanyl]ethylamino]methyl]pent-2-enyl]-6-ethyl-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxy]ethyl thiohypoiodite |
| SMILES | CC.CCOP(CCNC/C(=C/Cc1c(CC)c(C)c2c(c1OCCSI)C(=O)OC2)CC)OC |
| InChI | InChI=1S/C24H37INO5PS.C2H6/c1-6-18(15-26-11-13-32(28-5)31-8-3)9-10-20-19(7-2)17(4)21-16-30-24(27)22(21)23(20)29-12-14-33-25;1-2/h9,26H,6-8,10-16H2,1-5H3;1-2H3/b18-9+; |
| InChIKey | CWYQBJBGHBQBPM-WUBZALIBSA-N |
| XLogP | 7.18 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|