C15H22NO5P — CID 143041203
2-[2-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)ethylamino]ethylphosphonous acid (PubChem CID 143041203) has the molecular formula C15H22NO5P and a molecular weight of 327.32 g/mol. Its IUPAC name is 2-[2-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)ethylamino]ethylphosphonous acid.
| Compound Name | 2-[2-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)ethylamino]ethylphosphonous acid |
|---|---|
| PubChem CID | 143041203 |
| Molecular Formula | C15H22NO5P |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[2-(6-ethyl-4-hydroxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)ethylamino]ethylphosphonous acid |
| SMILES | CCc1c(C)c2c(c(O)c1CCNCCP(O)O)C(=O)OC2 |
| InChI | InChI=1S/C15H22NO5P/c1-3-10-9(2)12-8-21-15(18)13(12)14(17)11(10)4-5-16-6-7-22(19)20/h16-17,19-20H,3-8H2,1-2H3 |
| InChIKey | QPQVKSQNWXKASP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|