C21H27NO7 — CID 139590660
4-[[6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]butanoic acid (PubChem CID 139590660) has the molecular formula C21H27NO7 and a molecular weight of 405.45 g/mol. Its IUPAC name is 4-[[6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]butanoic acid.
| Compound Name | 4-[[6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139590660 |
| Molecular Formula | C21H27NO7 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 4-[[6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]butanoic acid |
| SMILES | COc1c(C)c2c(c(O)c1CC=C(C)CCC(=O)NCCCC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C21H27NO7/c1-12(7-9-16(23)22-10-4-5-17(24)25)6-8-14-19(26)18-15(11-29-21(18)27)13(2)20(14)28-3/h6,26H,4-5,7-11H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | WZYZXNKYQQZNNV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|