C26H38N2O7S2 — CID 173068847
tert-butyl N-[2-[2-[[6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]ethyldisulfanyl]ethyl]carbamate (PubChem CID 173068847) has the molecular formula C26H38N2O7S2 and a molecular weight of 554.73 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[[6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]ethyldisulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[[6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]ethyldisulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 173068847 |
| Molecular Formula | C26H38N2O7S2 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | tert-butyl N-[2-[2-[[6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]ethyldisulfanyl]ethyl]carbamate |
| SMILES | COc1c(C)c2c(c(O)c1CC=C(C)CCC(=O)NCCSSCCNC(=O)OC(C)(C)C)C(=O)OC2 |
| InChI | InChI=1S/C26H38N2O7S2/c1-16(7-9-18-22(30)21-19(15-34-24(21)31)17(2)23(18)33-6)8-10-20(29)27-11-13-36-37-14-12-28-25(32)35-26(3,4)5/h7,30H,8-15H2,1-6H3,(H,27,29)(H,28,32) |
| InChIKey | FJUAXJCJDOHDAL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|