C26H40N2O7S2 — CID 123622920
tert-butyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate;(E)-6-(4-hydroxy-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid (PubChem CID 123622920) has the molecular formula C26H40N2O7S2 and a molecular weight of 556.75 g/mol. Its IUPAC name is tert-butyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate;(E)-6-(4-hydroxy-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid.
| Compound Name | tert-butyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate;(E)-6-(4-hydroxy-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 123622920 |
| Molecular Formula | C26H40N2O7S2 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | tert-butyl N-[2-(2-aminoethyldisulfanyl)ethyl]carbamate;(E)-6-(4-hydroxy-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
| SMILES | C/C(=C\Cc1c(C)c(C)c2c(c1O)C(=O)OC2)CCC(=O)O.CC(C)(C)OC(=O)NCCSSCCN |
| InChI | InChI=1S/C17H20O5.C9H20N2O2S2/c1-9(5-7-14(18)19)4-6-12-10(2)11(3)13-8-22-17(21)15(13)16(12)20;1-9(2,3)13-8(12)11-5-7-15-14-6-4-10/h4,20H,5-8H2,1-3H3,(H,18,19);4-7,10H2,1-3H3,(H,11,12)/b9-4+; |
| InChIKey | UFAYSFRQUMYOTL-JOKMOOFLSA-N |
| XLogP | 4.88 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|