C27H28FNO7 — CID 89424077
(E)-6-[4-[3-[(2-fluorophenyl)methylamino]-3-oxopropanoyl]oxy-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 89424077) has the molecular formula C27H28FNO7 and a molecular weight of 497.52 g/mol. Its IUPAC name is (E)-6-[4-[3-[(2-fluorophenyl)methylamino]-3-oxopropanoyl]oxy-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-[4-[3-[(2-fluorophenyl)methylamino]-3-oxopropanoyl]oxy-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 89424077 |
| Molecular Formula | C27H28FNO7 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (E)-6-[4-[3-[(2-fluorophenyl)methylamino]-3-oxopropanoyl]oxy-6,7-dimethyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | C/C(=C\Cc1c(C)c(C)c2c(c1OC(=O)CC(=O)NCc1ccccc1F)C(=O)OC2)CCC(=O)O |
| InChI | InChI=1S/C27H28FNO7/c1-15(9-11-23(31)32)8-10-19-16(2)17(3)20-14-35-27(34)25(20)26(19)36-24(33)12-22(30)29-13-18-6-4-5-7-21(18)28/h4-8H,9-14H2,1-3H3,(H,29,30)(H,31,32)/b15-8+ |
| InChIKey | IVPUPRINLYDCGU-OVCLIPMQSA-N |
| XLogP | 4.08 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|