C18H22O6 — CID 101141979
methyl (E)-6-(4,6-dimethoxy-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (PubChem CID 101141979) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is methyl (E)-6-(4,6-dimethoxy-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate.
| Compound Name | methyl (E)-6-(4,6-dimethoxy-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 101141979 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | methyl (E)-6-(4,6-dimethoxy-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| SMILES | COC(=O)CC/C(C)=C/Cc1c(OC)cc2c(c1OC)C(=O)OC2 |
| InChI | InChI=1S/C18H22O6/c1-11(6-8-15(19)22-3)5-7-13-14(21-2)9-12-10-24-18(20)16(12)17(13)23-4/h5,9H,6-8,10H2,1-4H3/b11-5+ |
| InChIKey | UNEOKSJHQPTLJE-VZUCSPMQSA-N |
| XLogP | 2.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|