C26H28O7S — CID 87914894
(E)-6-[6-cyclopropyl-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 87914894) has the molecular formula C26H28O7S and a molecular weight of 484.57 g/mol. Its IUPAC name is (E)-6-[6-cyclopropyl-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-[6-cyclopropyl-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 87914894 |
| Molecular Formula | C26H28O7S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | (E)-6-[6-cyclopropyl-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | C/C(=C\Cc1c(OS(=O)(=O)c2ccc(C)cc2)c2c(c(C)c1C1CC1)COC2=O)CCC(=O)O |
| InChI | InChI=1S/C26H28O7S/c1-15-4-10-19(11-5-15)34(30,31)33-25-20(12-6-16(2)7-13-22(27)28)23(18-8-9-18)17(3)21-14-32-26(29)24(21)25/h4-6,10-11,18H,7-9,12-14H2,1-3H3,(H,27,28)/b16-6+ |
| InChIKey | DRAPRZQBFAJOQM-OMCISZLKSA-N |
| XLogP | 4.97 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|