C26H28O8S — CID 90738516
methyl 2-[2-[2-[6-hydroxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentyl]acetate (PubChem CID 90738516) has the molecular formula C26H28O8S and a molecular weight of 500.57 g/mol. Its IUPAC name is methyl 2-[2-[2-[6-hydroxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentyl]acetate.
| Compound Name | methyl 2-[2-[2-[6-hydroxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentyl]acetate |
|---|---|
| PubChem CID | 90738516 |
| Molecular Formula | C26H28O8S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | methyl 2-[2-[2-[6-hydroxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentyl]acetate |
| SMILES | COC(=O)CC1CCCC1=CCc1c(O)c(C)c2c(c1OS(=O)(=O)c1ccc(C)cc1)C(=O)OC2 |
| InChI | InChI=1S/C26H28O8S/c1-15-7-10-19(11-8-15)35(30,31)34-25-20(24(28)16(2)21-14-33-26(29)23(21)25)12-9-17-5-4-6-18(17)13-22(27)32-3/h7-11,18,28H,4-6,12-14H2,1-3H3 |
| InChIKey | LWYCNVRQTWGZIT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|