C26H25F3O7S — CID 57184117
methyl 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(1,2,2-trifluoroethenyl)-1H-2-benzofuran-5-yl]hex-4-enoate (PubChem CID 57184117) has the molecular formula C26H25F3O7S and a molecular weight of 538.54 g/mol. Its IUPAC name is methyl 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(1,2,2-trifluoroethenyl)-1H-2-benzofuran-5-yl]hex-4-enoate.
| Compound Name | methyl 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(1,2,2-trifluoroethenyl)-1H-2-benzofuran-5-yl]hex-4-enoate |
|---|---|
| PubChem CID | 57184117 |
| Molecular Formula | C26H25F3O7S |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | methyl 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(1,2,2-trifluoroethenyl)-1H-2-benzofuran-5-yl]hex-4-enoate |
| SMILES | COC(=O)CCC(C)=CCc1c(OS(=O)(=O)c2ccc(C)cc2)c2c(c(C)c1C(F)=C(F)F)COC2=O |
| InChI | InChI=1S/C26H25F3O7S/c1-14-5-9-17(10-6-14)37(32,33)36-24-18(11-7-15(2)8-12-20(30)34-4)21(23(27)25(28)29)16(3)19-13-35-26(31)22(19)24/h5-7,9-10H,8,11-13H2,1-4H3 |
| InChIKey | WLPKLKSRMHDLPE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|