C22H27F3O10S — CID 10840171
methyl (E)-6-[4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 10840171) has the molecular formula C22H27F3O10S and a molecular weight of 540.51 g/mol. Its IUPAC name is methyl (E)-6-[4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | methyl (E)-6-[4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 10840171 |
| Molecular Formula | C22H27F3O10S |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | methyl (E)-6-[4-(2-methoxyethoxymethoxy)-7-methyl-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COCCOCOc1c(C/C=C(\C)CCC(=O)OC)c(OS(=O)(=O)C(F)(F)F)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C22H27F3O10S/c1-13(6-8-17(26)31-4)5-7-15-19(35-36(28,29)22(23,24)25)14(2)16-11-33-21(27)18(16)20(15)34-12-32-10-9-30-3/h5H,6-12H2,1-4H3/b13-5+ |
| InChIKey | NSVBGKSLZXUHCG-WLRTZDKTSA-N |
| XLogP | 3.34 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|