C20H20F4O7S — CID 139746363
methyl (E)-6-[6-(2-fluoroethenyl)-7-methyl-3-oxo-4-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 139746363) has the molecular formula C20H20F4O7S and a molecular weight of 480.43 g/mol. Its IUPAC name is methyl (E)-6-[6-(2-fluoroethenyl)-7-methyl-3-oxo-4-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | methyl (E)-6-[6-(2-fluoroethenyl)-7-methyl-3-oxo-4-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 139746363 |
| Molecular Formula | C20H20F4O7S |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | methyl (E)-6-[6-(2-fluoroethenyl)-7-methyl-3-oxo-4-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COC(=O)CC/C(C)=C/Cc1c(C=CF)c(C)c2c(c1OS(=O)(=O)C(F)(F)F)C(=O)OC2 |
| InChI | InChI=1S/C20H20F4O7S/c1-11(5-7-16(25)29-3)4-6-14-13(8-9-21)12(2)15-10-30-19(26)17(15)18(14)31-32(27,28)20(22,23)24/h4,8-9H,5-7,10H2,1-3H3/b9-8?,11-4+ |
| InChIKey | ONMGILVCHQSBNN-VUWSQTKZSA-N |
| XLogP | 4.28 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|