C20H20FNO5 — CID 139746354
methyl (E)-6-[6-(2-fluoroethenyl)-4-isocyanato-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 139746354) has the molecular formula C20H20FNO5 and a molecular weight of 373.38 g/mol. Its IUPAC name is methyl (E)-6-[6-(2-fluoroethenyl)-4-isocyanato-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | methyl (E)-6-[6-(2-fluoroethenyl)-4-isocyanato-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 139746354 |
| Molecular Formula | C20H20FNO5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | methyl (E)-6-[6-(2-fluoroethenyl)-4-isocyanato-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COC(=O)CC/C(C)=C/Cc1c(C=CF)c(C)c2c(c1N=C=O)C(=O)OC2 |
| InChI | InChI=1S/C20H20FNO5/c1-12(5-7-17(24)26-3)4-6-15-14(8-9-21)13(2)16-10-27-20(25)18(16)19(15)22-11-23/h4,8-9H,5-7,10H2,1-3H3/b9-8?,12-4+ |
| InChIKey | XYRLBFSQYQSHKM-STSVXADLSA-N |
| XLogP | 4.01 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|