C24H23F3O10S2 — CID 54009126
4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]hex-4-enoic acid (PubChem CID 54009126) has the molecular formula C24H23F3O10S2 and a molecular weight of 592.57 g/mol. Its IUPAC name is 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]hex-4-enoic acid.
| Compound Name | 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 54009126 |
| Molecular Formula | C24H23F3O10S2 |
| Molecular Weight | 592.57 g/mol |
| Exact Mass | 592.07 |
| IUPAC Name | 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]hex-4-enoic acid |
| SMILES | CC(=CCc1c(OS(=O)(=O)C(F)(F)F)c(C)c2c(c1OS(=O)(=O)c1ccc(C)cc1)C(=O)OC2)CCC(=O)O |
| InChI | InChI=1S/C24H23F3O10S2/c1-13-4-8-16(9-5-13)38(31,32)36-22-17(10-6-14(2)7-11-19(28)29)21(37-39(33,34)24(25,26)27)15(3)18-12-35-23(30)20(18)22/h4-6,8-9H,7,10-12H2,1-3H3,(H,28,29) |
| InChIKey | KRAXNKNBJSLQMP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|