C28H22F3O10S2- — CID 19425496
3-methyl-2-[(E)-3-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]prop-1-enyl]benzoate (PubChem CID 19425496) has the molecular formula C28H22F3O10S2- and a molecular weight of 639.60 g/mol. Its IUPAC name is 3-methyl-2-[(E)-3-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]prop-1-enyl]benzoate.
| Compound Name | 3-methyl-2-[(E)-3-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 19425496 |
| Molecular Formula | C28H22F3O10S2- |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 639.06 |
| IUPAC Name | 3-methyl-2-[(E)-3-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]prop-1-enyl]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C/C=C/c3c(C)cccc3C(=O)[O-])c(OS(=O)(=O)C(F)(F)F)c(C)c3c2C(=O)OC3)cc1 |
| InChI | InChI=1S/C28H23F3O10S2/c1-15-10-12-18(13-11-15)42(35,36)40-25-21(9-5-7-19-16(2)6-4-8-20(19)26(32)33)24(41-43(37,38)28(29,30)31)17(3)22-14-39-27(34)23(22)25/h4-8,10-13H,9,14H2,1-3H3,(H,32,33)/p-1/b7-5+ |
| InChIKey | VHUWCLYILLSJLI-FNORWQNLSA-M |
| XLogP | 3.90 |
| TPSA | 153.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|