C24H24O8S — CID 19425437
(3E)-3-[2-[6-hydroxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentane-1-carboxylic acid (PubChem CID 19425437) has the molecular formula C24H24O8S and a molecular weight of 472.52 g/mol. Its IUPAC name is (3E)-3-[2-[6-hydroxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentane-1-carboxylic acid.
| Compound Name | (3E)-3-[2-[6-hydroxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 19425437 |
| Molecular Formula | C24H24O8S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | (3E)-3-[2-[6-hydroxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentane-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C/C=C3\CCC(C(=O)O)C3)c(O)c(C)c3c2C(=O)OC3)cc1 |
| InChI | InChI=1S/C24H24O8S/c1-13-3-8-17(9-4-13)33(29,30)32-22-18(10-6-15-5-7-16(11-15)23(26)27)21(25)14(2)19-12-31-24(28)20(19)22/h3-4,6,8-9,16,25H,5,7,10-12H2,1-2H3,(H,26,27)/b15-6+ |
| InChIKey | FPSOYFPXHJENTN-GIDUJCDVSA-N |
| XLogP | 3.80 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|