C27H27F3O10S2 — CID 19437163
methyl 2-[2-methyl-3-[[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]methyl]cyclopent-2-en-1-yl]acetate (PubChem CID 19437163) has the molecular formula C27H27F3O10S2 and a molecular weight of 632.63 g/mol. Its IUPAC name is methyl 2-[2-methyl-3-[[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]methyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | methyl 2-[2-methyl-3-[[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]methyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 19437163 |
| Molecular Formula | C27H27F3O10S2 |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.10 |
| IUPAC Name | methyl 2-[2-methyl-3-[[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]methyl]cyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)CC1CCC(Cc2c(OS(=O)(=O)C(F)(F)F)c(C)c3c(c2OS(=O)(=O)c2ccc(C)cc2)C(=O)OC3)=C1C |
| InChI | InChI=1S/C27H27F3O10S2/c1-14-5-9-19(10-6-14)41(33,34)39-25-20(11-17-7-8-18(15(17)2)12-22(31)37-4)24(40-42(35,36)27(28,29)30)16(3)21-13-38-26(32)23(21)25/h5-6,9-10,18H,7-8,11-13H2,1-4H3 |
| InChIKey | VRPFJBYCBYFVSX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|