C18H20O5S — CID 19046331
(3E)-3-[2-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)ethylidene]cyclopentane-1-carbothioic S-acid (PubChem CID 19046331) has the molecular formula C18H20O5S and a molecular weight of 348.42 g/mol. Its IUPAC name is (3E)-3-[2-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)ethylidene]cyclopentane-1-carbothioic S-acid.
| Compound Name | (3E)-3-[2-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)ethylidene]cyclopentane-1-carbothioic S-acid |
|---|---|
| PubChem CID | 19046331 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (3E)-3-[2-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)ethylidene]cyclopentane-1-carbothioic S-acid |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C1\CCC(C(=O)S)C1)C(=O)OC2 |
| InChI | InChI=1S/C18H20O5S/c1-9-13-8-23-17(20)14(13)15(19)12(16(9)22-2)6-4-10-3-5-11(7-10)18(21)24/h4,11,19H,3,5-8H2,1-2H3,(H,21,24)/b10-4+ |
| InChIKey | HSLZECDLDMXHQY-ONNFQVAWSA-N |
| XLogP | 3.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|