C37H37NO6 — CID 24749075
(E)-7-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-5-methyl-N-trityloxyhept-5-enamide (PubChem CID 24749075) has the molecular formula C37H37NO6 and a molecular weight of 591.70 g/mol. Its IUPAC name is (E)-7-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-5-methyl-N-trityloxyhept-5-enamide.
| Compound Name | (E)-7-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-5-methyl-N-trityloxyhept-5-enamide |
|---|---|
| PubChem CID | 24749075 |
| Molecular Formula | C37H37NO6 |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | (E)-7-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-5-methyl-N-trityloxyhept-5-enamide |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C(\C)CCCC(=O)NOC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC2 |
| InChI | InChI=1S/C37H37NO6/c1-25(22-23-30-34(40)33-31(24-43-36(33)41)26(2)35(30)42-3)14-13-21-32(39)38-44-37(27-15-7-4-8-16-27,28-17-9-5-10-18-28)29-19-11-6-12-20-29/h4-12,15-20,22,40H,13-14,21,23-24H2,1-3H3,(H,38,39)/b25-22+ |
| InChIKey | VLFPWXOZNZKNHB-YYDJUVGSSA-N |
| XLogP | 7.08 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|