C24H35O8P — CID 123785892
6-[(E)-9-diethoxyphosphoryl-3-methyl-6-oxonon-2-enyl]-7-hydroxy-5-methoxy-4-methyl-3H-2-benzofuran-1-one (PubChem CID 123785892) has the molecular formula C24H35O8P and a molecular weight of 482.51 g/mol. Its IUPAC name is 6-[(E)-9-diethoxyphosphoryl-3-methyl-6-oxonon-2-enyl]-7-hydroxy-5-methoxy-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 6-[(E)-9-diethoxyphosphoryl-3-methyl-6-oxonon-2-enyl]-7-hydroxy-5-methoxy-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 123785892 |
| Molecular Formula | C24H35O8P |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 6-[(E)-9-diethoxyphosphoryl-3-methyl-6-oxonon-2-enyl]-7-hydroxy-5-methoxy-4-methyl-3H-2-benzofuran-1-one |
| SMILES | CCOP(=O)(CCCC(=O)CC/C(C)=C/Cc1c(O)c2c(c(C)c1OC)COC2=O)OCC |
| InChI | InChI=1S/C24H35O8P/c1-6-31-33(28,32-7-2)14-8-9-18(25)12-10-16(3)11-13-19-22(26)21-20(15-30-24(21)27)17(4)23(19)29-5/h11,26H,6-10,12-15H2,1-5H3/b16-11+ |
| InChIKey | JRUGGEPTPXJOHU-LFIBNONCSA-N |
| XLogP | 5.26 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|