C26H30N2O6 — CID 67046307
phenyl (E)-6-[4-(dimethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 67046307) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is phenyl (E)-6-[4-(dimethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | phenyl (E)-6-[4-(dimethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 67046307 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | phenyl (E)-6-[4-(dimethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(NC(=O)N(C)C)c1C/C=C(\C)CCC(=O)Oc1ccccc1)C(=O)OC2 |
| InChI | InChI=1S/C26H30N2O6/c1-16(12-14-21(29)34-18-9-7-6-8-10-18)11-13-19-23(27-26(31)28(3)4)22-20(15-33-25(22)30)17(2)24(19)32-5/h6-11H,12-15H2,1-5H3,(H,27,31)/b16-11+ |
| InChIKey | JKQYETLTGHAZAS-LFIBNONCSA-N |
| XLogP | 4.64 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|