C20H22O7 — CID 57143899
2-[3-[(4-acetyloxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)methyl]cyclopent-2-en-1-yl]acetic acid (PubChem CID 57143899) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[3-[(4-acetyloxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)methyl]cyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[3-[(4-acetyloxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)methyl]cyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 57143899 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[3-[(4-acetyloxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)methyl]cyclopent-2-en-1-yl]acetic acid |
| SMILES | COc1c(C)c2c(c(OC(C)=O)c1CC1=CC(CC(=O)O)CC1)C(=O)OC2 |
| InChI | InChI=1S/C20H22O7/c1-10-15-9-26-20(24)17(15)19(27-11(2)21)14(18(10)25-3)7-12-4-5-13(6-12)8-16(22)23/h6,13H,4-5,7-9H2,1-3H3,(H,22,23) |
| InChIKey | YLGFBFAYULXUND-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|