C17H24O4S — CID 101021784
[(2R,3R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfonate (PubChem CID 101021784) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is [(2R,3R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101021784 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | [(2R,3R)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CC3CC(C3(C)C)[C@@]2(C)O)cc1 |
| InChI | InChI=1S/C17H24O4S/c1-11-5-7-13(8-6-11)22(19,20)21-15-10-12-9-14(16(12,2)3)17(15,4)18/h5-8,12,14-15,18H,9-10H2,1-4H3/t12?,14?,15-,17-/m1/s1 |
| InChIKey | AWPQDVPUDFAGME-MALUVHSTSA-N |
| XLogP | 2.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|