C19H20O4S — CID 10925989
[(1S,2R,5S)-1-methyl-5-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-methylbenzenesulfonate (PubChem CID 10925989) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is [(1S,2R,5S)-1-methyl-5-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,5S)-1-methyl-5-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10925989 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [(1S,2R,5S)-1-methyl-5-phenyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CC[C@@]3(c4ccccc4)O[C@@]23C)cc1 |
| InChI | InChI=1S/C19H20O4S/c1-14-8-10-16(11-9-14)24(20,21)22-17-12-13-19(18(17,2)23-19)15-6-4-3-5-7-15/h3-11,17H,12-13H2,1-2H3/t17-,18+,19+/m1/s1 |
| InChIKey | JROSBCIOZWAVPE-QYZOEREBSA-N |
| XLogP | 3.55 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|