C56H52N4O6S2 — CID 139040056
[(1R,3R,4S)-2,2-dicyano-3-ethyl-3,4-diphenylcyclopentyl] 4-methylbenzenesulfonate (PubChem CID 139040056) has the molecular formula C56H52N4O6S2 and a molecular weight of 941.19 g/mol. Its IUPAC name is [(1R,3R,4S)-2,2-dicyano-3-ethyl-3,4-diphenylcyclopentyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,3R,4S)-2,2-dicyano-3-ethyl-3,4-diphenylcyclopentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139040056 |
| Molecular Formula | C56H52N4O6S2 |
| Molecular Weight | 941.19 g/mol |
| Exact Mass | 940.33 |
| IUPAC Name | [(1R,3R,4S)-2,2-dicyano-3-ethyl-3,4-diphenylcyclopentyl] 4-methylbenzenesulfonate |
| SMILES | CC[C@]1(c2ccccc2)[C@H](c2ccccc2)C[C@@H](OS(=O)(=O)c2ccc(C)cc2)C1(C#N)C#N.CC[C@]1(c2ccccc2)[C@H](c2ccccc2)C[C@@H](OS(=O)(=O)c2ccc(C)cc2)C1(C#N)C#N |
| InChI | InChI=1S/2C28H26N2O3S/c2*1-3-28(23-12-8-5-9-13-23)25(22-10-6-4-7-11-22)18-26(27(28,19-29)20-30)33-34(31,32)24-16-14-21(2)15-17-24/h2*4-17,25-26H,3,18H2,1-2H3/t2*25-,26+,28-/m00/s1 |
| InChIKey | BOWZPQTZTYWJFM-ILDZFREUSA-N |
| XLogP | 11.28 |
| TPSA | 181.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.19 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|