C24H25O4PS — CID 59622404
[(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]methyl 4-methylbenzenesulfonate (PubChem CID 59622404) has the molecular formula C24H25O4PS and a molecular weight of 440.50 g/mol. Its IUPAC name is [(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59622404 |
| Molecular Formula | C24H25O4PS |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | [(2S,5S)-1-oxo-2,5-diphenyl-1λ5-phospholan-1-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCP2(=O)[C@H](c3ccccc3)CC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25O4PS/c1-19-12-14-22(15-13-19)30(26,27)28-18-29(25)23(20-8-4-2-5-9-20)16-17-24(29)21-10-6-3-7-11-21/h2-15,23-24H,16-18H2,1H3/t23-,24-/m0/s1 |
| InChIKey | BCOLELRBUUJRCE-ZEQRLZLVSA-N |
| XLogP | 6.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|