C18H19F2NO3S — CID 125492485
[(3R)-1-benzyl-4,4-difluoropyrrolidin-3-yl] 4-methylbenzenesulfonate (PubChem CID 125492485) has the molecular formula C18H19F2NO3S and a molecular weight of 367.42 g/mol. Its IUPAC name is [(3R)-1-benzyl-4,4-difluoropyrrolidin-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3R)-1-benzyl-4,4-difluoropyrrolidin-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 125492485 |
| Molecular Formula | C18H19F2NO3S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [(3R)-1-benzyl-4,4-difluoropyrrolidin-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2CN(Cc3ccccc3)CC2(F)F)cc1 |
| InChI | InChI=1S/C18H19F2NO3S/c1-14-7-9-16(10-8-14)25(22,23)24-17-12-21(13-18(17,19)20)11-15-5-3-2-4-6-15/h2-10,17H,11-13H2,1H3/t17-/m1/s1 |
| InChIKey | HSLBAAAWBGBHTM-QGZVFWFLSA-N |
| XLogP | 3.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|