C25H27NO6S2 — CID 98044880
[(3S,4S)-1-benzyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-3-yl] 4-methylbenzenesulfonate (PubChem CID 98044880) has the molecular formula C25H27NO6S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is [(3S,4S)-1-benzyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,4S)-1-benzyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 98044880 |
| Molecular Formula | C25H27NO6S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | [(3S,4S)-1-benzyl-4-(4-methylphenyl)sulfonyloxypyrrolidin-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CN(Cc3ccccc3)C[C@@H]2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H27NO6S2/c1-19-8-12-22(13-9-19)33(27,28)31-24-17-26(16-21-6-4-3-5-7-21)18-25(24)32-34(29,30)23-14-10-20(2)11-15-23/h3-15,24-25H,16-18H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | AIFJHMSGSPJHOH-DQEYMECFSA-N |
| XLogP | 3.67 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|