C23H24BrNO3S2 — CID 58624930
[1-benzyl-4-(4-bromothiophen-2-yl)pyrrolidin-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58624930) has the molecular formula C23H24BrNO3S2 and a molecular weight of 506.49 g/mol. Its IUPAC name is [1-benzyl-4-(4-bromothiophen-2-yl)pyrrolidin-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [1-benzyl-4-(4-bromothiophen-2-yl)pyrrolidin-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58624930 |
| Molecular Formula | C23H24BrNO3S2 |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | [1-benzyl-4-(4-bromothiophen-2-yl)pyrrolidin-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CN(Cc3ccccc3)CC2c2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C23H24BrNO3S2/c1-17-7-9-21(10-8-17)30(26,27)28-15-19-13-25(12-18-5-3-2-4-6-18)14-22(19)23-11-20(24)16-29-23/h2-11,16,19,22H,12-15H2,1H3 |
| InChIKey | AEHNXBBOAUDXDE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|