C21H30O6S — CID 10894861
[(4aR,6aS,7R,9aR,9bS)-9a-hydroxy-3-methoxy-6a-methyl-1,3,4,4a,5,6,7,8,9,9b-decahydrocyclopenta[h]isochromen-7-yl] 4-methylbenzenesulfonate (PubChem CID 10894861) has the molecular formula C21H30O6S and a molecular weight of 410.53 g/mol. Its IUPAC name is [(4aR,6aS,7R,9aR,9bS)-9a-hydroxy-3-methoxy-6a-methyl-1,3,4,4a,5,6,7,8,9,9b-decahydrocyclopenta[h]isochromen-7-yl] 4-methylbenzenesulfonate.
| Compound Name | [(4aR,6aS,7R,9aR,9bS)-9a-hydroxy-3-methoxy-6a-methyl-1,3,4,4a,5,6,7,8,9,9b-decahydrocyclopenta[h]isochromen-7-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10894861 |
| Molecular Formula | C21H30O6S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [(4aR,6aS,7R,9aR,9bS)-9a-hydroxy-3-methoxy-6a-methyl-1,3,4,4a,5,6,7,8,9,9b-decahydrocyclopenta[h]isochromen-7-yl] 4-methylbenzenesulfonate |
| SMILES | COC1C[C@H]2CC[C@@]3(C)[C@H](OS(=O)(=O)c4ccc(C)cc4)CC[C@@]3(O)[C@@H]2CO1 |
| InChI | InChI=1S/C21H30O6S/c1-14-4-6-16(7-5-14)28(23,24)27-18-9-11-21(22)17-13-26-19(25-3)12-15(17)8-10-20(18,21)2/h4-7,15,17-19,22H,8-13H2,1-3H3/t15-,17-,18-,19?,20+,21-/m1/s1 |
| InChIKey | GVEVRGHGMVEGCV-RTDDNFMASA-N |
| XLogP | 3.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|