C19H26O4S — CID 10545821
[(1S,4R,4aS,8aS)-4-hydroxy-4,8a-dimethyl-1,2,3,4a,7,8-hexahydronaphthalen-1-yl] 4-methylbenzenesulfonate (PubChem CID 10545821) has the molecular formula C19H26O4S and a molecular weight of 350.48 g/mol. Its IUPAC name is [(1S,4R,4aS,8aS)-4-hydroxy-4,8a-dimethyl-1,2,3,4a,7,8-hexahydronaphthalen-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,4R,4aS,8aS)-4-hydroxy-4,8a-dimethyl-1,2,3,4a,7,8-hexahydronaphthalen-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10545821 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [(1S,4R,4aS,8aS)-4-hydroxy-4,8a-dimethyl-1,2,3,4a,7,8-hexahydronaphthalen-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CC[C@@](C)(O)[C@H]3C=CCC[C@]23C)cc1 |
| InChI | InChI=1S/C19H26O4S/c1-14-7-9-15(10-8-14)24(21,22)23-17-11-13-19(3,20)16-6-4-5-12-18(16,17)2/h4,6-10,16-17,20H,5,11-13H2,1-3H3/t16-,17-,18-,19+/m0/s1 |
| InChIKey | GVXFFFYBPZOADN-CADBVGFASA-N |
| XLogP | 3.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|