C16H19BrO3S — CID 134865830
[(1S,2Z,6Z)-2-bromocyclonona-2,6-dien-1-yl] 4-methylbenzenesulfonate (PubChem CID 134865830) has the molecular formula C16H19BrO3S and a molecular weight of 371.30 g/mol. Its IUPAC name is [(1S,2Z,6Z)-2-bromocyclonona-2,6-dien-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2Z,6Z)-2-bromocyclonona-2,6-dien-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134865830 |
| Molecular Formula | C16H19BrO3S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | [(1S,2Z,6Z)-2-bromocyclonona-2,6-dien-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CC/C=C/CC/C=C/2Br)cc1 |
| InChI | InChI=1S/C16H19BrO3S/c1-13-9-11-14(12-10-13)21(18,19)20-16-8-6-4-2-3-5-7-15(16)17/h2,4,7,9-12,16H,3,5-6,8H2,1H3/b4-2+,15-7-/t16-/m0/s1 |
| InChIKey | KGHJHQXIKJKLEW-OZFAFVNYSA-N |
| XLogP | 4.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|