C17H22O4S — CID 51350595
[(1S,3aS,7aR)-3a-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl] 4-methylbenzenesulfonate (PubChem CID 51350595) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is [(1S,3aS,7aR)-3a-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,3aS,7aR)-3a-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 51350595 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [(1S,3aS,7aR)-3a-hydroxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CC[C@]3(O)C=CCC[C@]23C)cc1 |
| InChI | InChI=1S/C17H22O4S/c1-13-5-7-14(8-6-13)22(19,20)21-15-9-12-17(18)11-4-3-10-16(15,17)2/h4-8,11,15,18H,3,9-10,12H2,1-2H3/t15-,16+,17+/m0/s1 |
| InChIKey | VNFHHLUPTZDKOL-GVDBMIGSSA-N |
| XLogP | 2.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|