C18H26O4S — CID 10936684
[(1S,2S,5R)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-methylbenzenesulfonate (PubChem CID 10936684) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is [(1S,2S,5R)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2S,5R)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10936684 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [(1S,2S,5R)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCC[C@@]12O[C@]1(C)CC[C@@H]2OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H26O4S/c1-4-5-6-12-18-16(11-13-17(18,3)22-18)21-23(19,20)15-9-7-14(2)8-10-15/h7-10,16H,4-6,11-13H2,1-3H3/t16-,17+,18-/m0/s1 |
| InChIKey | ZKBIAHILDIPDFN-KSZLIROESA-N |
| XLogP | 3.97 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|