About [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate
[(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate (PubChem CID 10959173) has the molecular formula C18H26O5S
and a molecular weight of 354.47 g/mol. Its IUPAC name is [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate.
Molecular Properties
| Compound Name | [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate |
| PubChem CID | 10959173 |
| Molecular Formula | C18H26O5S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate |
| SMILES | CCCCC[C@@]1(C)CC[C@H](OS(=O)(=O)c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C18H26O5S/c1-4-5-6-12-18(2)13-11-16(17(18)19)23-24(20,21)15-9-7-14(22-3)8-10-15/h7-10,16H,4-6,11-13H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | AHIBSVJHRNZZFI-WMZOPIPTSA-N |
| XLogP | 3.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate?
The IUPAC name of [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate (CID 10959173) is [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate.
What is the SMILES notation for [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate?
The canonical SMILES for [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate is CCCCC[C@@]1(C)CC[C@H](OS(=O)(=O)c2ccc(OC)cc2)C1=O.
What is the InChIKey of [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate?
The InChIKey is AHIBSVJHRNZZFI-WMZOPIPTSA-N. The full InChI is InChI=1S/C18H26O5S/c1-4-5-6-12-18(2)13-11-16(17(18)19)23-24(20,21)15-9-7-14(22-3)8-10-15/h7-10,16H,4-6,11-13H2,1-3H3/t16-,18-/m0/s1.
What are the key properties of [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate?
[(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate has a molecular weight of 354.47 g/mol, XLogP of 3.72, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-3-methyl-2-oxo-3-pentylcyclopentyl] 4-methoxybenzenesulfonate is sourced from PubChem (CID 10959173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).