C20H31BrO — CID 18596669
1-[2-(4-bromo-4-pentylcyclohexyl)ethyl]-4-methoxybenzene (PubChem CID 18596669) has the molecular formula C20H31BrO and a molecular weight of 367.37 g/mol. Its IUPAC name is 1-[2-(4-bromo-4-pentylcyclohexyl)ethyl]-4-methoxybenzene.
| Compound Name | 1-[2-(4-bromo-4-pentylcyclohexyl)ethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 18596669 |
| Molecular Formula | C20H31BrO |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[2-(4-bromo-4-pentylcyclohexyl)ethyl]-4-methoxybenzene |
| SMILES | CCCCCC1(Br)CCC(CCc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H31BrO/c1-3-4-5-14-20(21)15-12-18(13-16-20)7-6-17-8-10-19(22-2)11-9-17/h8-11,18H,3-7,12-16H2,1-2H3 |
| InChIKey | HVOUFTDMHSQLFD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|