C23H33BrO — CID 18656557
1-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-4-methoxybenzene (PubChem CID 18656557) has the molecular formula C23H33BrO and a molecular weight of 405.42 g/mol. Its IUPAC name is 1-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-4-methoxybenzene.
| Compound Name | 1-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 18656557 |
| Molecular Formula | C23H33BrO |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-4-methoxybenzene |
| SMILES | COc1ccc(CCC2CCC(C3CCC(/C=C/Br)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H33BrO/c1-25-23-14-8-19(9-15-23)3-2-18-4-10-21(11-5-18)22-12-6-20(7-13-22)16-17-24/h8-9,14-18,20-22H,2-7,10-13H2,1H3/b17-16+ |
| InChIKey | FXAIJRTVEPPPEV-WUKNDPDISA-N |
| XLogP | 7.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |