C22H29Br2F — CID 18656533
1-bromo-4-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-2-fluorobenzene (PubChem CID 18656533) has the molecular formula C22H29Br2F and a molecular weight of 472.28 g/mol. Its IUPAC name is 1-bromo-4-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-2-fluorobenzene.
| Compound Name | 1-bromo-4-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 18656533 |
| Molecular Formula | C22H29Br2F |
| Molecular Weight | 472.28 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 1-bromo-4-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-2-fluorobenzene |
| SMILES | Fc1cc(CCC2CCC(C3CCC(/C=C/Br)CC3)CC2)ccc1Br |
| InChI | InChI=1S/C22H29Br2F/c23-14-13-17-5-10-20(11-6-17)19-8-3-16(4-9-19)1-2-18-7-12-21(24)22(25)15-18/h7,12-17,19-20H,1-6,8-11H2/b14-13+ |
| InChIKey | DHDZNHFPWDHUME-BUHFOSPRSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.28 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |