C22H30BrF — CID 18656555
1-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-4-fluorobenzene (PubChem CID 18656555) has the molecular formula C22H30BrF and a molecular weight of 393.38 g/mol. Its IUPAC name is 1-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-4-fluorobenzene.
| Compound Name | 1-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 18656555 |
| Molecular Formula | C22H30BrF |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[2-[4-[4-[(E)-2-bromoethenyl]cyclohexyl]cyclohexyl]ethyl]-4-fluorobenzene |
| SMILES | Fc1ccc(CCC2CCC(C3CCC(/C=C/Br)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H30BrF/c23-16-15-19-5-11-21(12-6-19)20-9-3-17(4-10-20)1-2-18-7-13-22(24)14-8-18/h7-8,13-17,19-21H,1-6,9-12H2/b16-15+ |
| InChIKey | GVOHSNWWBRQNPR-FOCLMDBBSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |